C16H18BrN — CID 43105030
N-[1-(4-bromophenyl)ethyl]-2,4-dimethylaniline (PubChem CID 43105030) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2,4-dimethylaniline.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 43105030 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(NC(C)c2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C16H18BrN/c1-11-4-9-16(12(2)10-11)18-13(3)14-5-7-15(17)8-6-14/h4-10,13,18H,1-3H3 |
| InChIKey | UIHWDPIOLIRGMN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |