C15H17BrN2O2S — CID 43105910
5-[1-(4-bromophenyl)ethylamino]-2-methylbenzenesulfonamide (PubChem CID 43105910) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is 5-[1-(4-bromophenyl)ethylamino]-2-methylbenzenesulfonamide.
| Compound Name | 5-[1-(4-bromophenyl)ethylamino]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43105910 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 5-[1-(4-bromophenyl)ethylamino]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(NC(C)c2ccc(Br)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H17BrN2O2S/c1-10-3-8-14(9-15(10)21(17,19)20)18-11(2)12-4-6-13(16)7-5-12/h3-9,11,18H,1-2H3,(H2,17,19,20) |
| InChIKey | HEUAFJHAFFUPOK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |