C22H31NO3Si — CID 102326549
3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 102326549) has the molecular formula C22H31NO3Si and a molecular weight of 385.58 g/mol. Its IUPAC name is 3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102326549 |
| Molecular Formula | C22H31NO3Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@H](C(=O)N2CCOC2=O)[C@@H](c2ccccc2)C=C(C[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C22H31NO3Si/c1-15-16(2)20(21(24)23-11-12-26-22(23)25)19(17-9-7-6-8-10-17)13-18(15)14-27(3,4)5/h6-10,13,15-16,19-20H,11-12,14H2,1-5H3/t15-,16+,19+,20-/m0/s1 |
| InChIKey | KXYNWWMAXDOOQG-FIYPYCPBSA-N |
| XLogP | 4.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|