C24H23O14+ — CID 102326854
2-[[(2R,3R,4R,5S)-5-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoacetic acid (PubChem CID 102326854) has the molecular formula C24H23O14+ and a molecular weight of 535.43 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5S)-5-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoacetic acid.
| Compound Name | 2-[[(2R,3R,4R,5S)-5-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 102326854 |
| Molecular Formula | C24H23O14+ |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 2-[[(2R,3R,4R,5S)-5-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoacetic acid |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2O[C@H](COC(=O)C(=O)O)[C@H](O)[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C24H22O14/c1-33-14-3-9(4-15(34-2)18(14)27)21-16(7-11-12(26)5-10(25)6-13(11)36-21)37-24-20(29)19(28)17(38-24)8-35-23(32)22(30)31/h3-7,17,19-20,24,28-29H,8H2,1-2H3,(H3-,25,26,27,30,31)/p+1/t17-,19+,20-,24-/m1/s1 |
| InChIKey | WVFVWEOFXLMKLY-SSYAZSBWSA-O |
| XLogP | 0.97 |
| TPSA | 212.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|