C23H23O13+ — CID 135030653
(3R,6R)-6-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 135030653) has the molecular formula C23H23O13+ and a molecular weight of 507.42 g/mol. Its IUPAC name is (3R,6R)-6-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,6R)-6-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 135030653 |
| Molecular Formula | C23H23O13+ |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (3R,6R)-6-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@H]2OC(C(=O)O)[C@H](O)C(O)C2O)cc(OC)c1O |
| InChI | InChI=1S/C23H22O13/c1-32-13-3-8(4-14(33-2)16(13)26)20-15(7-10-11(25)5-9(24)6-12(10)34-20)35-23-19(29)17(27)18(28)21(36-23)22(30)31/h3-7,17-19,21,23,27-29H,1-2H3,(H3-,24,25,26,30,31)/p+1/t17?,18-,19?,21?,23+/m1/s1 |
| InChIKey | UYZBTMBWXANOMA-QJLGUMDFSA-O |
| XLogP | 0.79 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|