C21H21O11+ — CID 101072176
(3S,4R,5R)-2-[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol (PubChem CID 101072176) has the molecular formula C21H21O11+ and a molecular weight of 449.39 g/mol. Its IUPAC name is (3S,4R,5R)-2-[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,4R,5R)-2-[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 101072176 |
| Molecular Formula | C21H21O11+ |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (3S,4R,5R)-2-[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2OC2OC[C@@H](O)[C@@H](O)[C@@H]2O)cc(O)c1O |
| InChI | InChI=1S/C21H20O11/c1-29-15-3-8(2-12(24)17(15)26)20-16(32-21-19(28)18(27)13(25)7-30-21)6-10-11(23)4-9(22)5-14(10)31-20/h2-6,13,18-19,21,25,27-28H,7H2,1H3,(H3-,22,23,24,26)/p+1/t13-,18-,19+,21?/m1/s1 |
| InChIKey | XYWFSSFJPFAYCA-OETOTGFOSA-O |
| XLogP | 1.03 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|