C20H19ClO10 — CID 24721044
(2S,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol chloride (PubChem CID 24721044) has the molecular formula C20H19ClO10 and a molecular weight of 454.82 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol chloride.
| Compound Name | (2S,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol chloride |
|---|---|
| PubChem CID | 24721044 |
| Molecular Formula | C20H19ClO10 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (2S,3S,4R,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol chloride |
| SMILES | Oc1cc(O)c2cc(O[C@@H]3OC[C@@H](O)[C@@H](O)[C@@H]3O)c(-c3ccc(O)c(O)c3)[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C20H18O10.ClH/c21-9-4-12(23)10-6-16(30-20-18(27)17(26)14(25)7-28-20)19(29-15(10)5-9)8-1-2-11(22)13(24)3-8;/h1-6,14,17-18,20,25-27H,7H2,(H3-,21,22,23,24);1H/t14-,17-,18+,20+;/m1./s1 |
| InChIKey | ORTBMTXABUAMJS-VGEDXCMYSA-N |
| XLogP | -1.97 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|