C14H20O3 — CID 102328528
(1S,4S,7R,13R)-5,5-dimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione (PubChem CID 102328528) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,4S,7R,13R)-5,5-dimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione.
| Compound Name | (1S,4S,7R,13R)-5,5-dimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione |
|---|---|
| PubChem CID | 102328528 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,4S,7R,13R)-5,5-dimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione |
| SMILES | CC1(C)C[C@H]2C(=O)CCCC[C@@H]3C(=O)O[C@H]1[C@@H]32 |
| InChI | InChI=1S/C14H20O3/c1-14(2)7-9-10(15)6-4-3-5-8-11(9)12(14)17-13(8)16/h8-9,11-12H,3-7H2,1-2H3/t8-,9-,11-,12-/m0/s1 |
| InChIKey | POBYMSCWODSEAQ-QSFUFRPTSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |