C17H26O5 — CID 134950541
(1S,4S,13R)-6,10-dimethoxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione (PubChem CID 134950541) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1S,4S,13R)-6,10-dimethoxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione.
| Compound Name | (1S,4S,13R)-6,10-dimethoxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione |
|---|---|
| PubChem CID | 134950541 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (1S,4S,13R)-6,10-dimethoxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridecane-2,8-dione |
| SMILES | COC1CC[C@@H]2C(=O)O[C@H]3[C@@H]2C(C(=O)C1C)C(OC)C3(C)C |
| InChI | InChI=1S/C17H26O5/c1-8-10(20-4)7-6-9-11-12(13(8)18)14(21-5)17(2,3)15(11)22-16(9)19/h8-12,14-15H,6-7H2,1-5H3/t8?,9-,10?,11-,12?,14?,15-/m0/s1 |
| InChIKey | SCXZOYOUXQJHKM-JJGGFBIESA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |