C14H12O5 — CID 102328631
[(2R,3E)-2-hydroxy-3-(5-oxofuran-2-ylidene)propyl] benzoate (PubChem CID 102328631) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is [(2R,3E)-2-hydroxy-3-(5-oxofuran-2-ylidene)propyl] benzoate.
| Compound Name | [(2R,3E)-2-hydroxy-3-(5-oxofuran-2-ylidene)propyl] benzoate |
|---|---|
| PubChem CID | 102328631 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [(2R,3E)-2-hydroxy-3-(5-oxofuran-2-ylidene)propyl] benzoate |
| SMILES | O=C1C=C/C(=C\[C@@H](O)COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H12O5/c15-11(8-12-6-7-13(16)19-12)9-18-14(17)10-4-2-1-3-5-10/h1-8,11,15H,9H2/b12-8+/t11-/m1/s1 |
| InChIKey | WQHRXHYOKDRIRR-OYGDSYQHSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |