C36H61N3O4 — CID 102330398
3-[(E)-dodec-2-enyl]-1-[2-[2-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]ethylamino]ethyl]pyrrolidine-2,5-dione (PubChem CID 102330398) has the molecular formula C36H61N3O4 and a molecular weight of 599.90 g/mol. Its IUPAC name is 3-[(E)-dodec-2-enyl]-1-[2-[2-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]ethylamino]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(E)-dodec-2-enyl]-1-[2-[2-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]ethylamino]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102330398 |
| Molecular Formula | C36H61N3O4 |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 599.47 |
| IUPAC Name | 3-[(E)-dodec-2-enyl]-1-[2-[2-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]ethylamino]ethyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCCCC/C=C/CC1CC(=O)N(CCNCCN2C(=O)CC(C/C=C/CCCCCCCCC)C2=O)C1=O |
| InChI | InChI=1S/C36H61N3O4/c1-3-5-7-9-11-13-15-17-19-21-23-31-29-33(40)38(35(31)42)27-25-37-26-28-39-34(41)30-32(36(39)43)24-22-20-18-16-14-12-10-8-6-4-2/h19-22,31-32,37H,3-18,23-30H2,1-2H3/b21-19+,22-20+ |
| InChIKey | HRADYKHRFISDEA-FLFKKZLDSA-N |
| XLogP | 7.50 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|