C20H33NO4 — CID 172907326
3-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]butanoic acid (PubChem CID 172907326) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 3-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]butanoic acid.
| Compound Name | 3-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 172907326 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 3-[3-[(E)-dodec-2-enyl]-2,5-dioxopyrrolidin-1-yl]butanoic acid |
| SMILES | CCCCCCCCC/C=C/CC1CC(=O)N(C(C)CC(=O)O)C1=O |
| InChI | InChI=1S/C20H33NO4/c1-3-4-5-6-7-8-9-10-11-12-13-17-15-18(22)21(20(17)25)16(2)14-19(23)24/h11-12,16-17H,3-10,13-15H2,1-2H3,(H,23,24)/b12-11+ |
| InChIKey | HMKHROVPCTUMJR-VAWYXSNFSA-N |
| XLogP | 4.31 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|