C15H31BO — CID 102331515
2,3-dimethylbutan-2-yl-[(Z)-3-methoxyprop-1-enyl]-(3-methylbutan-2-yl)borane (PubChem CID 102331515) has the molecular formula C15H31BO and a molecular weight of 238.22 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(Z)-3-methoxyprop-1-enyl]-(3-methylbutan-2-yl)borane.
| Compound Name | 2,3-dimethylbutan-2-yl-[(Z)-3-methoxyprop-1-enyl]-(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 102331515 |
| Molecular Formula | C15H31BO |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.25 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(Z)-3-methoxyprop-1-enyl]-(3-methylbutan-2-yl)borane |
| SMILES | COC/C=C\B(C(C)C(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H31BO/c1-12(2)14(5)16(10-9-11-17-8)15(6,7)13(3)4/h9-10,12-14H,11H2,1-8H3/b10-9- |
| InChIKey | KABIZUDIFZWTMK-KTKRTIGZSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|