C24H26N2O2 — CID 102331556
4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzonitrile (PubChem CID 102331556) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzonitrile.
| Compound Name | 4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzonitrile |
|---|---|
| PubChem CID | 102331556 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl)benzonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(C#N)cc1)C1=C(C2)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C24H26N2O2/c1-23(2)10-19-17(21(27)12-23)9-18-20(11-24(3,4)13-22(18)28)26(19)16-7-5-15(14-25)6-8-16/h5-8H,9-13H2,1-4H3 |
| InChIKey | ZFVNCWVREABGGY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |