C27H38N2S8 — CID 10233208
5-[4-[3-[3-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-3-methylbutyl]sulfanylpropylsulfanyl]-2-methylbutan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 10233208) has the molecular formula C27H38N2S8 and a molecular weight of 647.15 g/mol. Its IUPAC name is 5-[4-[3-[3-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-3-methylbutyl]sulfanylpropylsulfanyl]-2-methylbutan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-[4-[3-[3-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-3-methylbutyl]sulfanylpropylsulfanyl]-2-methylbutan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 10233208 |
| Molecular Formula | C27H38N2S8 |
| Molecular Weight | 647.15 g/mol |
| Exact Mass | 646.08 |
| IUPAC Name | 5-[4-[3-[3-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-3-methylbutyl]sulfanylpropylsulfanyl]-2-methylbutan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CC(C)(CCSCCCSCCC(C)(C)N1C(=S)C=C2SCCC2C1=S)N1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C27H38N2S8/c1-26(2,28-22(30)16-20-18(24(28)32)6-12-36-20)8-14-34-10-5-11-35-15-9-27(3,4)29-23(31)17-21-19(25(29)33)7-13-37-21/h16-19H,5-15H2,1-4H3 |
| InChIKey | STGYNNRJWRQCEK-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.15 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|