C31H46N2S8 — CID 20633453
5-[5-[3-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-4,4-dimethylpentyl]sulfanylpropylsulfanyl]-2,2-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 20633453) has the molecular formula C31H46N2S8 and a molecular weight of 703.26 g/mol. Its IUPAC name is 5-[5-[3-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-4,4-dimethylpentyl]sulfanylpropylsulfanyl]-2,2-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-[5-[3-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-4,4-dimethylpentyl]sulfanylpropylsulfanyl]-2,2-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 20633453 |
| Molecular Formula | C31H46N2S8 |
| Molecular Weight | 703.26 g/mol |
| Exact Mass | 702.14 |
| IUPAC Name | 5-[5-[3-[5-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-4,4-dimethylpentyl]sulfanylpropylsulfanyl]-2,2-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CC(C)(CCCSCCCSCCCC(C)(C)CN1C(=S)C=C2SCCC2C1=S)CN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C31H46N2S8/c1-30(2,20-32-26(34)18-24-22(28(32)36)8-16-40-24)10-5-12-38-14-7-15-39-13-6-11-31(3,4)21-33-27(35)19-25-23(29(33)37)9-17-41-25/h18-19,22-23H,5-17,20-21H2,1-4H3 |
| InChIKey | GEXWEFXZKIWKSU-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.26 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|