C34H44ClF3N4O3 — CID 10233235
1-[(2R)-2-[(1-amino-1,2,3,4-tetrahydronaphthalene-2-carbonyl)amino]-3-(4-chlorophenyl)propanoyl]-N-tert-butyl-4-(4,4,4-trifluorobutyl)piperidine-4-carboxamide (PubChem CID 10233235) has the molecular formula C34H44ClF3N4O3 and a molecular weight of 649.20 g/mol. Its IUPAC name is 1-[(2R)-2-[(1-amino-1,2,3,4-tetrahydronaphthalene-2-carbonyl)amino]-3-(4-chlorophenyl)propanoyl]-N-tert-butyl-4-(4,4,4-trifluorobutyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-[(1-amino-1,2,3,4-tetrahydronaphthalene-2-carbonyl)amino]-3-(4-chlorophenyl)propanoyl]-N-tert-butyl-4-(4,4,4-trifluorobutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 10233235 |
| Molecular Formula | C34H44ClF3N4O3 |
| Molecular Weight | 649.20 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | 1-[(2R)-2-[(1-amino-1,2,3,4-tetrahydronaphthalene-2-carbonyl)amino]-3-(4-chlorophenyl)propanoyl]-N-tert-butyl-4-(4,4,4-trifluorobutyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1(CCCC(F)(F)F)CCN(C(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)C2CCc3ccccc3C2N)CC1 |
| InChI | InChI=1S/C34H44ClF3N4O3/c1-32(2,3)41-31(45)33(15-6-16-34(36,37)38)17-19-42(20-18-33)30(44)27(21-22-9-12-24(35)13-10-22)40-29(43)26-14-11-23-7-4-5-8-25(23)28(26)39/h4-5,7-10,12-13,26-28H,6,11,14-21,39H2,1-3H3,(H,40,43)(H,41,45)/t26?,27-,28?/m1/s1 |
| InChIKey | XGPYXBUXHXORDC-QBYNGQAISA-N |
| XLogP | 5.89 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.20 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |