C37H55ClN4O3 — CID 142031635
N-[(2R)-1-[4-(tert-butylcarbamoyl)-4-cyclohexylpiperidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]-4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine-2-carboxamide;ethane (PubChem CID 142031635) has the molecular formula C37H55ClN4O3 and a molecular weight of 639.33 g/mol. Its IUPAC name is N-[(2R)-1-[4-(tert-butylcarbamoyl)-4-cyclohexylpiperidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]-4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine-2-carboxamide;ethane.
| Compound Name | N-[(2R)-1-[4-(tert-butylcarbamoyl)-4-cyclohexylpiperidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]-4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142031635 |
| Molecular Formula | C37H55ClN4O3 |
| Molecular Weight | 639.33 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | N-[(2R)-1-[4-(tert-butylcarbamoyl)-4-cyclohexylpiperidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]-4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine-2-carboxamide;ethane |
| SMILES | C=CC1=C(C=C)CC(C(=O)N[C@H](Cc2ccc(Cl)cc2)C(=O)N2CCC(C(=O)NC(C)(C)C)(C3CCCCC3)CC2)NC1.CC |
| InChI | InChI=1S/C35H49ClN4O3.C2H6/c1-6-25-22-29(37-23-26(25)7-2)31(41)38-30(21-24-13-15-28(36)16-14-24)32(42)40-19-17-35(18-20-40,27-11-9-8-10-12-27)33(43)39-34(3,4)5;1-2/h6-7,13-16,27,29-30,37H,1-2,8-12,17-23H2,3-5H3,(H,38,41)(H,39,43);1-2H3/t29?,30-;/m1./s1 |
| InChIKey | CGDHDRDYLDOGBF-YPPOXEGYSA-N |
| XLogP | 6.53 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.33 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |