C37H51FN4O3S2 — CID 142117260
CID 142117260 (PubChem CID 142117260) has the molecular formula C37H51FN4O3S2 and a molecular weight of 682.97 g/mol.
| Compound Name | CID 142117260 |
|---|---|
| PubChem CID | 142117260 |
| Molecular Formula | C37H51FN4O3S2 |
| Molecular Weight | 682.97 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | — |
| SMILES | C=CC1=C(C=C)C2CC1C(N)C2C(=O)N[C@H](Cc1ccc(F)cc1)C(=O)N1CCC(C(=O)NC(C)(C)C)(C2CCCCC2)CC1.S=S |
| InChI | InChI=1S/C37H51FN4O3.S2/c1-6-26-27(7-2)29-22-28(26)31(32(29)39)33(43)40-30(21-23-13-15-25(38)16-14-23)34(44)42-19-17-37(18-20-42,24-11-9-8-10-12-24)35(45)41-36(3,4)5;1-2/h6-7,13-16,24,28-32H,1-2,8-12,17-22,39H2,3-5H3,(H,40,43)(H,41,45);/t28?,29?,30-,31?,32?;/m1./s1 |
| InChIKey | LJFCPOIBVGJBPF-JJWCPQPYSA-N |
| XLogP | 5.21 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.97 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |