C34H47ClN6O3 — CID 22949107
N-tert-butyl-1-[3-(4-chlorophenyl)-2-[[2-(5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-5-yl)acetyl]amino]propanoyl]-4-cyclohexylpiperidine-4-carboxamide (PubChem CID 22949107) has the molecular formula C34H47ClN6O3 and a molecular weight of 623.24 g/mol. Its IUPAC name is N-tert-butyl-1-[3-(4-chlorophenyl)-2-[[2-(5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-5-yl)acetyl]amino]propanoyl]-4-cyclohexylpiperidine-4-carboxamide.
| Compound Name | N-tert-butyl-1-[3-(4-chlorophenyl)-2-[[2-(5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-5-yl)acetyl]amino]propanoyl]-4-cyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22949107 |
| Molecular Formula | C34H47ClN6O3 |
| Molecular Weight | 623.24 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | N-tert-butyl-1-[3-(4-chlorophenyl)-2-[[2-(5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-5-yl)acetyl]amino]propanoyl]-4-cyclohexylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1(C2CCCCC2)CCN(C(=O)C(Cc2ccc(Cl)cc2)NC(=O)CC2NCCc3nccnc32)CC1 |
| InChI | InChI=1S/C34H47ClN6O3/c1-33(2,3)40-32(44)34(24-7-5-4-6-8-24)14-19-41(20-15-34)31(43)28(21-23-9-11-25(35)12-10-23)39-29(42)22-27-30-26(13-16-36-27)37-17-18-38-30/h9-12,17-18,24,27-28,36H,4-8,13-16,19-22H2,1-3H3,(H,39,42)(H,40,44) |
| InChIKey | NVSIFYGIWDORQM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |