C19H26N4O4 — CID 102333976
methyl 5-[3-[(1-amino-3-methyl-1-oxobutan-2-yl)carbamoyl]indazol-1-yl]pentanoate (PubChem CID 102333976) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 5-[3-[(1-amino-3-methyl-1-oxobutan-2-yl)carbamoyl]indazol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-[(1-amino-3-methyl-1-oxobutan-2-yl)carbamoyl]indazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 102333976 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 5-[3-[(1-amino-3-methyl-1-oxobutan-2-yl)carbamoyl]indazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1nc(C(=O)NC(C(N)=O)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H26N4O4/c1-12(2)16(18(20)25)21-19(26)17-13-8-4-5-9-14(13)23(22-17)11-7-6-10-15(24)27-3/h4-5,8-9,12,16H,6-7,10-11H2,1-3H3,(H2,20,25)(H,21,26) |
| InChIKey | AXRQQLPJJDLVJN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|