C26H25NO — CID 102334236
(1S)-N-[(S)-(2-methoxynaphthalen-1-yl)-phenylmethyl]-1-phenylethanamine (PubChem CID 102334236) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is (1S)-N-[(S)-(2-methoxynaphthalen-1-yl)-phenylmethyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[(S)-(2-methoxynaphthalen-1-yl)-phenylmethyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 102334236 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (1S)-N-[(S)-(2-methoxynaphthalen-1-yl)-phenylmethyl]-1-phenylethanamine |
| SMILES | COc1ccc2ccccc2c1[C@@H](N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO/c1-19(20-11-5-3-6-12-20)27-26(22-14-7-4-8-15-22)25-23-16-10-9-13-21(23)17-18-24(25)28-2/h3-19,26-27H,1-2H3/t19-,26-/m0/s1 |
| InChIKey | XMKWGCPLGMGMNH-SIBVEZHUSA-N |
| XLogP | 6.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |