C26H21NO3 — CID 2882665
[1-[acetamido(phenyl)methyl]naphthalen-2-yl] benzoate (PubChem CID 2882665) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is [1-[acetamido(phenyl)methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[acetamido(phenyl)methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 2882665 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [1-[acetamido(phenyl)methyl]naphthalen-2-yl] benzoate |
| SMILES | CC(=O)NC(c1ccccc1)c1c(OC(=O)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C26H21NO3/c1-18(28)27-25(20-11-4-2-5-12-20)24-22-15-9-8-10-19(22)16-17-23(24)30-26(29)21-13-6-3-7-14-21/h2-17,25H,1H3,(H,27,28) |
| InChIKey | YITKCAYDJXOQQT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|