C28H25NO5 — CID 2225937
[1-[(R)-acetamido-(4-methoxyphenyl)methyl]naphthalen-2-yl] 2-phenoxyacetate (PubChem CID 2225937) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is [1-[(R)-acetamido-(4-methoxyphenyl)methyl]naphthalen-2-yl] 2-phenoxyacetate.
| Compound Name | [1-[(R)-acetamido-(4-methoxyphenyl)methyl]naphthalen-2-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 2225937 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [1-[(R)-acetamido-(4-methoxyphenyl)methyl]naphthalen-2-yl] 2-phenoxyacetate |
| SMILES | COc1ccc([C@@H](NC(C)=O)c2c(OC(=O)COc3ccccc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H25NO5/c1-19(30)29-28(21-12-15-22(32-2)16-13-21)27-24-11-7-6-8-20(24)14-17-25(27)34-26(31)18-33-23-9-4-3-5-10-23/h3-17,28H,18H2,1-2H3,(H,29,30)/t28-/m1/s1 |
| InChIKey | BXILDFBDHOPQHW-MUUNZHRXSA-N |
| XLogP | 5.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|