C8H11NO3 — CID 102335279
(1R,6S,8S)-1,6-dihydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 102335279) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (1R,6S,8S)-1,6-dihydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1R,6S,8S)-1,6-dihydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 102335279 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (1R,6S,8S)-1,6-dihydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=C1C(=O)N2C[C@@H](O)C[C@H]2[C@@H]1O |
| InChI | InChI=1S/C8H11NO3/c1-4-7(11)6-2-5(10)3-9(6)8(4)12/h5-7,10-11H,1-3H2/t5-,6-,7+/m0/s1 |
| InChIKey | DUZKGMZNMOSZKA-LYFYHCNISA-N |
| XLogP | -1.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|