C8H11NO2 — CID 130146821
1-hydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 130146821) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-hydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | 1-hydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 130146821 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1-hydroxy-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=C1C(=O)N2CCCC2C1O |
| InChI | InChI=1S/C8H11NO2/c1-5-7(10)6-3-2-4-9(6)8(5)11/h6-7,10H,1-4H2 |
| InChIKey | YZYMYDPKARHUSA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|