C40H76N2O6 — CID 10233599
4-[(E)-13-amino-12-hydroxyoctadec-9-enoyl]oxybutyl (E)-13-amino-12-hydroxyoctadec-9-enoate (PubChem CID 10233599) has the molecular formula C40H76N2O6 and a molecular weight of 681.06 g/mol. Its IUPAC name is 4-[(E)-13-amino-12-hydroxyoctadec-9-enoyl]oxybutyl (E)-13-amino-12-hydroxyoctadec-9-enoate.
| Compound Name | 4-[(E)-13-amino-12-hydroxyoctadec-9-enoyl]oxybutyl (E)-13-amino-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 10233599 |
| Molecular Formula | C40H76N2O6 |
| Molecular Weight | 681.06 g/mol |
| Exact Mass | 680.57 |
| IUPAC Name | 4-[(E)-13-amino-12-hydroxyoctadec-9-enoyl]oxybutyl (E)-13-amino-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC(N)C(O)C/C=C/CCCCCCCC(=O)OCCCCOC(=O)CCCCCCC/C=C/CC(O)C(N)CCCCC |
| InChI | InChI=1S/C40H76N2O6/c1-3-5-19-27-35(41)37(43)29-21-15-11-7-9-13-17-23-31-39(45)47-33-25-26-34-48-40(46)32-24-18-14-10-8-12-16-22-30-38(44)36(42)28-20-6-4-2/h15-16,21-22,35-38,43-44H,3-14,17-20,23-34,41-42H2,1-2H3/b21-15+,22-16+ |
| InChIKey | BLKPOLACCBQVNC-YHARCJFQSA-N |
| XLogP | 8.74 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.06 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|