C20H12F6N2O — CID 102337691
2,18-bis(trifluoromethyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one (PubChem CID 102337691) has the molecular formula C20H12F6N2O and a molecular weight of 410.32 g/mol. Its IUPAC name is 2,18-bis(trifluoromethyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one.
| Compound Name | 2,18-bis(trifluoromethyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one |
|---|---|
| PubChem CID | 102337691 |
| Molecular Formula | C20H12F6N2O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2,18-bis(trifluoromethyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14(19),15,17-heptaen-9-one |
| SMILES | O=C1c2ccccc2C2(C(F)(F)F)c3[nH]c4c(C(F)(F)F)cccc4c3CCN12 |
| InChI | InChI=1S/C20H12F6N2O/c21-19(22,23)14-7-3-5-10-11-8-9-28-17(29)12-4-1-2-6-13(12)18(28,20(24,25)26)16(11)27-15(10)14/h1-7,27H,8-9H2 |
| InChIKey | KYOLOXPSJLKFMI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |