C35H37NO3 — CID 102339579
(2S,3R,4R)-1-benzyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 102339579) has the molecular formula C35H37NO3 and a molecular weight of 519.69 g/mol. Its IUPAC name is (2S,3R,4R)-1-benzyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2S,3R,4R)-1-benzyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 102339579 |
| Molecular Formula | C35H37NO3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (2S,3R,4R)-1-benzyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | C=C1CN(Cc2ccccc2)[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO3/c1-28-22-36(23-29-14-6-2-7-15-29)33(27-37-24-30-16-8-3-9-17-30)35(39-26-32-20-12-5-13-21-32)34(28)38-25-31-18-10-4-11-19-31/h2-21,33-35H,1,22-27H2/t33-,34+,35+/m0/s1 |
| InChIKey | XCFADWZPHAWUHP-BMPTZRATSA-N |
| XLogP | 6.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|