C20H26O3 — CID 102339708
(1R,4aR,7S)-7-ethenyl-10-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,5,6,8-tetrahydrophenanthren-9-one (PubChem CID 102339708) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1R,4aR,7S)-7-ethenyl-10-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,5,6,8-tetrahydrophenanthren-9-one.
| Compound Name | (1R,4aR,7S)-7-ethenyl-10-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,5,6,8-tetrahydrophenanthren-9-one |
|---|---|
| PubChem CID | 102339708 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1R,4aR,7S)-7-ethenyl-10-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,5,6,8-tetrahydrophenanthren-9-one |
| SMILES | C=C[C@@]1(C)CCC2=C(C1)C(=O)C(O)=C1[C@](C)(CO)CC=C[C@]21C |
| InChI | InChI=1S/C20H26O3/c1-5-18(2)10-7-14-13(11-18)15(22)16(23)17-19(3,12-21)8-6-9-20(14,17)4/h5-6,9,21,23H,1,7-8,10-12H2,2-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | GSIFPNBGQDHODX-SLFFLAALSA-N |
| XLogP | 4.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|