C19H26O4 — CID 132525351
(4S,4aS,7R,9R,10aS)-7-ethenyl-4,9-dihydroxy-1-(hydroxymethyl)-4a,7-dimethyl-5,6,8,9,10,10a-hexahydro-4H-phenanthren-3-one (PubChem CID 132525351) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (4S,4aS,7R,9R,10aS)-7-ethenyl-4,9-dihydroxy-1-(hydroxymethyl)-4a,7-dimethyl-5,6,8,9,10,10a-hexahydro-4H-phenanthren-3-one.
| Compound Name | (4S,4aS,7R,9R,10aS)-7-ethenyl-4,9-dihydroxy-1-(hydroxymethyl)-4a,7-dimethyl-5,6,8,9,10,10a-hexahydro-4H-phenanthren-3-one |
|---|---|
| PubChem CID | 132525351 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4S,4aS,7R,9R,10aS)-7-ethenyl-4,9-dihydroxy-1-(hydroxymethyl)-4a,7-dimethyl-5,6,8,9,10,10a-hexahydro-4H-phenanthren-3-one |
| SMILES | C=C[C@]1(C)CCC2=C(C1)[C@H](O)C[C@H]1C(CO)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C19H26O4/c1-4-18(2)6-5-13-12(9-18)15(21)8-14-11(10-20)7-16(22)17(23)19(13,14)3/h4,7,14-15,17,20-21,23H,1,5-6,8-10H2,2-3H3/t14-,15+,17+,18+,19+/m0/s1 |
| InChIKey | BUUHDERFHDMSIH-ZPKKHLQPSA-N |
| XLogP | 1.91 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|