C39H31ClN2O9S — CID 10234057
4-[(2-chlorophenyl)sulfonylcarbamoyl]-6-[(3-phenoxyphenyl)methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 10234057) has the molecular formula C39H31ClN2O9S and a molecular weight of 739.20 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)sulfonylcarbamoyl]-6-[(3-phenoxyphenyl)methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[(2-chlorophenyl)sulfonylcarbamoyl]-6-[(3-phenoxyphenyl)methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 10234057 |
| Molecular Formula | C39H31ClN2O9S |
| Molecular Weight | 739.20 g/mol |
| Exact Mass | 738.14 |
| IUPAC Name | 4-[(2-chlorophenyl)sulfonylcarbamoyl]-6-[(3-phenoxyphenyl)methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)N(Cc2cccc(Oc3ccccc3)c2)[C@H]2CCCc3ccccc32)cc1C(=O)NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C39H31ClN2O9S/c40-33-17-6-7-19-35(33)52(49,50)41-36(43)29-21-30(32(39(47)48)22-31(29)38(45)46)37(44)42(34-18-9-12-25-11-4-5-16-28(25)34)23-24-10-8-15-27(20-24)51-26-13-2-1-3-14-26/h1-8,10-11,13-17,19-22,34H,9,12,18,23H2,(H,41,43)(H,45,46)(H,47,48)/t34-/m0/s1 |
| InChIKey | DMYOQOHAKWXNCX-UMSFTDKQSA-N |
| XLogP | 7.37 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.20 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |