C35H30N2O8 — CID 87964534
5-[[3-[(E)-phenylmethoxyiminomethyl]phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 87964534) has the molecular formula C35H30N2O8 and a molecular weight of 606.63 g/mol. Its IUPAC name is 5-[[3-[(E)-phenylmethoxyiminomethyl]phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 5-[[3-[(E)-phenylmethoxyiminomethyl]phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 87964534 |
| Molecular Formula | C35H30N2O8 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 5-[[3-[(E)-phenylmethoxyiminomethyl]phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)N(Cc2cccc(/C=N/OCc3ccccc3)c2)[C@H]2CCCc3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C35H30N2O8/c38-32(27-17-29(34(41)42)30(35(43)44)18-28(27)33(39)40)37(31-15-7-13-25-12-4-5-14-26(25)31)20-24-11-6-10-23(16-24)19-36-45-21-22-8-2-1-3-9-22/h1-6,8-12,14,16-19,31H,7,13,15,20-21H2,(H,39,40)(H,41,42)(H,43,44)/b36-19+/t31-/m0/s1 |
| InChIKey | YDAQOBACCPCYKK-FNQZQSCWSA-N |
| XLogP | 6.05 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|