C22H30O7 — CID 102341070
triethyl (6S,7R)-4-oxatricyclo[8.4.0.02,6]tetradeca-1,10-diene-7,13,13-tricarboxylate (PubChem CID 102341070) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is triethyl (6S,7R)-4-oxatricyclo[8.4.0.02,6]tetradeca-1,10-diene-7,13,13-tricarboxylate.
| Compound Name | triethyl (6S,7R)-4-oxatricyclo[8.4.0.02,6]tetradeca-1,10-diene-7,13,13-tricarboxylate |
|---|---|
| PubChem CID | 102341070 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | triethyl (6S,7R)-4-oxatricyclo[8.4.0.02,6]tetradeca-1,10-diene-7,13,13-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC2=CCC(C(=O)OCC)(C(=O)OCC)CC2=C2COC[C@H]21 |
| InChI | InChI=1S/C22H30O7/c1-4-27-19(23)15-8-7-14-9-10-22(20(24)28-5-2,21(25)29-6-3)11-16(14)18-13-26-12-17(15)18/h9,15,17H,4-8,10-13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | IWYRQSBVSQKEFN-WBVHZDCISA-N |
| XLogP | 2.74 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|