C15H18O5 — CID 10516713
dimethyl 4,5-dimethylidene-6,8-dihydro-1H-isochromene-7,7-dicarboxylate (PubChem CID 10516713) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl 4,5-dimethylidene-6,8-dihydro-1H-isochromene-7,7-dicarboxylate.
| Compound Name | dimethyl 4,5-dimethylidene-6,8-dihydro-1H-isochromene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 10516713 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl 4,5-dimethylidene-6,8-dihydro-1H-isochromene-7,7-dicarboxylate |
| SMILES | C=C1COCC2=C1C(=C)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C15H18O5/c1-9-5-15(13(16)18-3,14(17)19-4)6-11-8-20-7-10(2)12(9)11/h1-2,5-8H2,3-4H3 |
| InChIKey | SJLWGTYOFYDGHA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|