C18H24O5 — CID 11110006
diethyl 4,5-dimethylidene-1,6,7,9-tetrahydrocyclohepta[c]pyran-8,8-dicarboxylate (PubChem CID 11110006) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is diethyl 4,5-dimethylidene-1,6,7,9-tetrahydrocyclohepta[c]pyran-8,8-dicarboxylate.
| Compound Name | diethyl 4,5-dimethylidene-1,6,7,9-tetrahydrocyclohepta[c]pyran-8,8-dicarboxylate |
|---|---|
| PubChem CID | 11110006 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | diethyl 4,5-dimethylidene-1,6,7,9-tetrahydrocyclohepta[c]pyran-8,8-dicarboxylate |
| SMILES | C=C1CCC(C(=O)OCC)(C(=O)OCC)CC2=C1C(=C)COC2 |
| InChI | InChI=1S/C18H24O5/c1-5-22-16(19)18(17(20)23-6-2)8-7-12(3)15-13(4)10-21-11-14(15)9-18/h3-11H2,1-2H3 |
| InChIKey | KCCFOLQMARHROP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|