C22H34O5 — CID 102342409
2-[(2'S,7S,8R,8aS)-2'-(hydroxymethyl)-4,4,7,8a-tetramethyl-6-oxospiro[1,2,3,7-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]ethyl acetate (PubChem CID 102342409) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[(2'S,7S,8R,8aS)-2'-(hydroxymethyl)-4,4,7,8a-tetramethyl-6-oxospiro[1,2,3,7-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]ethyl acetate.
| Compound Name | 2-[(2'S,7S,8R,8aS)-2'-(hydroxymethyl)-4,4,7,8a-tetramethyl-6-oxospiro[1,2,3,7-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]ethyl acetate |
|---|---|
| PubChem CID | 102342409 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[(2'S,7S,8R,8aS)-2'-(hydroxymethyl)-4,4,7,8a-tetramethyl-6-oxospiro[1,2,3,7-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@]1(CO)CC[C@@]2(O1)[C@H](C)C(=O)C=C1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C22H34O5/c1-15-17(25)13-18-19(3,4)7-6-8-20(18,5)22(15)10-9-21(14-23,27-22)11-12-26-16(2)24/h13,15,23H,6-12,14H2,1-5H3/t15-,20+,21+,22-/m1/s1 |
| InChIKey | BEBCDUYLNQVSLW-NSEXGNSCSA-N |
| XLogP | 3.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |