C22H34O6 — CID 162973645
[1-(3,4-dihydroxy-5-oxooxolan-3-yl)-2-(1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl] acetate (PubChem CID 162973645) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is [1-(3,4-dihydroxy-5-oxooxolan-3-yl)-2-(1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl] acetate.
| Compound Name | [1-(3,4-dihydroxy-5-oxooxolan-3-yl)-2-(1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl] acetate |
|---|---|
| PubChem CID | 162973645 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [1-(3,4-dihydroxy-5-oxooxolan-3-yl)-2-(1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl] acetate |
| SMILES | CC(=O)OC(CC1(C)C(C)CC=C2C1CCCC2(C)C)C1(O)COC(=O)C1O |
| InChI | InChI=1S/C22H34O6/c1-13-8-9-15-16(7-6-10-20(15,3)4)21(13,5)11-17(28-14(2)23)22(26)12-27-19(25)18(22)24/h9,13,16-18,24,26H,6-8,10-12H2,1-5H3 |
| InChIKey | QCPWZRPDZHMSDZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|