C22H26O8 — CID 44567137
[(3R,3aR,4S,9aR,9bS)-3-acetyl-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-hydroxy-2-methyl-3-oxobutanoate (PubChem CID 44567137) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is [(3R,3aR,4S,9aR,9bS)-3-acetyl-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-hydroxy-2-methyl-3-oxobutanoate.
| Compound Name | [(3R,3aR,4S,9aR,9bS)-3-acetyl-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-hydroxy-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 44567137 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [(3R,3aR,4S,9aR,9bS)-3-acetyl-3,6,9-trimethyl-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-hydroxy-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)(O)C(=O)O[C@H]1CC(C)=C2C(=O)C=C(C)[C@H]2[C@@H]2OC(=O)[C@@](C)(C(C)=O)[C@@H]21 |
| InChI | InChI=1S/C22H26O8/c1-9-7-13(25)15-10(2)8-14(29-20(27)22(6,28)12(4)24)17-18(16(9)15)30-19(26)21(17,5)11(3)23/h7,14,16-18,28H,8H2,1-6H3/t14-,16+,17+,18-,21-,22?/m0/s1 |
| InChIKey | ZPHPEKHFBAXIMQ-LUOGVEEYSA-N |
| XLogP | 1.24 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|