C18H18BrN3O5 — CID 102344144
1-(3-bromophenyl)-N-carbamoyl-3-hydroxy-6,6-dimethyl-2,4-dioxo-5,7-dihydroindole-3-carboxamide (PubChem CID 102344144) has the molecular formula C18H18BrN3O5 and a molecular weight of 436.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-carbamoyl-3-hydroxy-6,6-dimethyl-2,4-dioxo-5,7-dihydroindole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-carbamoyl-3-hydroxy-6,6-dimethyl-2,4-dioxo-5,7-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 102344144 |
| Molecular Formula | C18H18BrN3O5 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 1-(3-bromophenyl)-N-carbamoyl-3-hydroxy-6,6-dimethyl-2,4-dioxo-5,7-dihydroindole-3-carboxamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1cccc(Br)c1)C(=O)C2(O)C(=O)NC(N)=O |
| InChI | InChI=1S/C18H18BrN3O5/c1-17(2)7-11-13(12(23)8-17)18(27,14(24)21-16(20)26)15(25)22(11)10-5-3-4-9(19)6-10/h3-6,27H,7-8H2,1-2H3,(H3,20,21,24,26) |
| InChIKey | WFCAQWPDTKFGNR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|