C22H30N2O — CID 102344555
[(3R)-11-diazo-2,6,9,9-tetramethylundeca-1,6,7-trien-3-yl]oxymethylbenzene (PubChem CID 102344555) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is [(3R)-11-diazo-2,6,9,9-tetramethylundeca-1,6,7-trien-3-yl]oxymethylbenzene.
| Compound Name | [(3R)-11-diazo-2,6,9,9-tetramethylundeca-1,6,7-trien-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 102344555 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | [(3R)-11-diazo-2,6,9,9-tetramethylundeca-1,6,7-trien-3-yl]oxymethylbenzene |
| SMILES | C=C(C)[C@@H](CCC(C)=C=CC(C)(C)CC=[N+]=[N-])OCc1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-18(2)21(25-17-20-9-7-6-8-10-20)12-11-19(3)13-14-22(4,5)15-16-24-23/h6-10,14,16,21H,1,11-12,15,17H2,2-5H3/t13?,21-/m1/s1 |
| InChIKey | WXHUSCGVWUIIBU-QUXALOBESA-N |
| XLogP | 5.75 |
| TPSA | 45.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|