C46H38P2+2 — CID 102345877
cyclopenta-2,4-dien-1-yl-[4-[4-[cyclopenta-2,4-dien-1-yl(diphenyl)phosphaniumyl]phenyl]phenyl]-diphenylphosphanium (PubChem CID 102345877) has the molecular formula C46H38P2+2 and a molecular weight of 652.76 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-[4-[4-[cyclopenta-2,4-dien-1-yl(diphenyl)phosphaniumyl]phenyl]phenyl]-diphenylphosphanium.
| Compound Name | cyclopenta-2,4-dien-1-yl-[4-[4-[cyclopenta-2,4-dien-1-yl(diphenyl)phosphaniumyl]phenyl]phenyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 102345877 |
| Molecular Formula | C46H38P2+2 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-[4-[4-[cyclopenta-2,4-dien-1-yl(diphenyl)phosphaniumyl]phenyl]phenyl]-diphenylphosphanium |
| SMILES | C1=CC([P+](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc([P+](c4ccccc4)(c4ccccc4)C4C=CC=C4)cc3)cc2)C=C1 |
| InChI | InChI=1S/C46H38P2/c1-5-17-39(18-6-1)47(43-25-13-14-26-43,40-19-7-2-8-20-40)45-33-29-37(30-34-45)38-31-35-46(36-32-38)48(44-27-15-16-28-44,41-21-9-3-10-22-41)42-23-11-4-12-24-42/h1-36,43-44H/q+2 |
| InChIKey | AQKKNEDDHXYMHQ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|