C31H25BrF3O3P — CID 102346319
ethyl 5-(4-bromophenyl)-2,2,2-triphenyl-5-(trifluoromethyl)-1,2λ5-oxaphosphole-4-carboxylate (PubChem CID 102346319) has the molecular formula C31H25BrF3O3P and a molecular weight of 613.41 g/mol. Its IUPAC name is ethyl 5-(4-bromophenyl)-2,2,2-triphenyl-5-(trifluoromethyl)-1,2λ5-oxaphosphole-4-carboxylate.
| Compound Name | ethyl 5-(4-bromophenyl)-2,2,2-triphenyl-5-(trifluoromethyl)-1,2λ5-oxaphosphole-4-carboxylate |
|---|---|
| PubChem CID | 102346319 |
| Molecular Formula | C31H25BrF3O3P |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | ethyl 5-(4-bromophenyl)-2,2,2-triphenyl-5-(trifluoromethyl)-1,2λ5-oxaphosphole-4-carboxylate |
| SMILES | CCOC(=O)C1=CP(c2ccccc2)(c2ccccc2)(c2ccccc2)OC1(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H25BrF3O3P/c1-2-37-29(36)28-22-39(25-12-6-3-7-13-25,26-14-8-4-9-15-26,27-16-10-5-11-17-27)38-30(28,31(33,34)35)23-18-20-24(32)21-19-23/h3-22H,2H2,1H3 |
| InChIKey | IWXKKXZMANMGKN-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|