C29H26O9 — CID 102346348
6,10,19-tris(methoxymethoxy)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene-3,13,16-tricarbaldehyde (PubChem CID 102346348) has the molecular formula C29H26O9 and a molecular weight of 518.52 g/mol. Its IUPAC name is 6,10,19-tris(methoxymethoxy)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene-3,13,16-tricarbaldehyde.
| Compound Name | 6,10,19-tris(methoxymethoxy)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene-3,13,16-tricarbaldehyde |
|---|---|
| PubChem CID | 102346348 |
| Molecular Formula | C29H26O9 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 6,10,19-tris(methoxymethoxy)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene-3,13,16-tricarbaldehyde |
| SMILES | COCOc1ccc(C=O)c2c1C1c3c(OCOC)ccc(C=O)c3C2c2c(C=O)ccc(OCOC)c21 |
| InChI | InChI=1S/C29H26O9/c1-33-13-36-19-7-4-16(10-30)22-25(19)29-26-20(37-14-34-2)8-5-17(11-31)23(26)28(22)24-18(12-32)6-9-21(27(24)29)38-15-35-3/h4-12,28-29H,13-15H2,1-3H3 |
| InChIKey | OKXJJPJKNABMTL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|