C19H13F5N2 — CID 102346547
6-butyl-2,9,10,11,12-pentafluoroindazolo[3,2-a]isoquinoline (PubChem CID 102346547) has the molecular formula C19H13F5N2 and a molecular weight of 364.32 g/mol. Its IUPAC name is 6-butyl-2,9,10,11,12-pentafluoroindazolo[3,2-a]isoquinoline.
| Compound Name | 6-butyl-2,9,10,11,12-pentafluoroindazolo[3,2-a]isoquinoline |
|---|---|
| PubChem CID | 102346547 |
| Molecular Formula | C19H13F5N2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 6-butyl-2,9,10,11,12-pentafluoroindazolo[3,2-a]isoquinoline |
| SMILES | CCCCc1cc2ccc(F)cc2c2c3c(F)c(F)c(F)c(F)c3nn12 |
| InChI | InChI=1S/C19H13F5N2/c1-2-3-4-11-7-9-5-6-10(20)8-12(9)19-13-14(21)15(22)16(23)17(24)18(13)25-26(11)19/h5-8H,2-4H2,1H3 |
| InChIKey | RAABLCKOGAWWRW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|