C18H15FN2 — CID 4187113
N-(4-fluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine (PubChem CID 4187113) has the molecular formula C18H15FN2 and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine.
| Compound Name | N-(4-fluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
|---|---|
| PubChem CID | 4187113 |
| Molecular Formula | C18H15FN2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(4-fluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
| SMILES | Fc1ccc(Nc2c3c(nc4ccccc24)CCC3)cc1 |
| InChI | InChI=1S/C18H15FN2/c19-12-8-10-13(11-9-12)20-18-14-4-1-2-6-16(14)21-17-7-3-5-15(17)18/h1-2,4,6,8-11H,3,5,7H2,(H,20,21) |
| InChIKey | DLVFOWXHKPEVTF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |