C18H25F2NO7 — CID 102348566
benzyl N-[(2R,3S)-4,4-difluoro-2,3-dihydroxy-5-(2-methoxyethoxymethoxy)hex-5-enyl]carbamate (PubChem CID 102348566) has the molecular formula C18H25F2NO7 and a molecular weight of 405.39 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-4,4-difluoro-2,3-dihydroxy-5-(2-methoxyethoxymethoxy)hex-5-enyl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-4,4-difluoro-2,3-dihydroxy-5-(2-methoxyethoxymethoxy)hex-5-enyl]carbamate |
|---|---|
| PubChem CID | 102348566 |
| Molecular Formula | C18H25F2NO7 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | benzyl N-[(2R,3S)-4,4-difluoro-2,3-dihydroxy-5-(2-methoxyethoxymethoxy)hex-5-enyl]carbamate |
| SMILES | C=C(OCOCCOC)C(F)(F)[C@@H](O)[C@H](O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25F2NO7/c1-13(28-12-26-9-8-25-2)18(19,20)16(23)15(22)10-21-17(24)27-11-14-6-4-3-5-7-14/h3-7,15-16,22-23H,1,8-12H2,2H3,(H,21,24)/t15-,16+/m1/s1 |
| InChIKey | KOGCLRHGNWYYCM-CVEARBPZSA-N |
| XLogP | 1.42 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|