C18H23F2NO5 — CID 102348564
benzyl N-[(2E)-4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-2,5-dienyl]carbamate (PubChem CID 102348564) has the molecular formula C18H23F2NO5 and a molecular weight of 371.38 g/mol. Its IUPAC name is benzyl N-[(2E)-4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-2,5-dienyl]carbamate.
| Compound Name | benzyl N-[(2E)-4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-2,5-dienyl]carbamate |
|---|---|
| PubChem CID | 102348564 |
| Molecular Formula | C18H23F2NO5 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | benzyl N-[(2E)-4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-2,5-dienyl]carbamate |
| SMILES | C=C(OCOCCOC)C(F)(F)/C=C/CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23F2NO5/c1-15(26-14-24-12-11-23-2)18(19,20)9-6-10-21-17(22)25-13-16-7-4-3-5-8-16/h3-9H,1,10-14H2,2H3,(H,21,22)/b9-6+ |
| InChIKey | AWZKRZJXSKOUKZ-RMKNXTFCSA-N |
| XLogP | 3.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|