C18H24F3NO3 — CID 10522461
2,2,2-trifluoro-N-[(E,3R,6S)-2-methyl-6-(phenylmethoxymethoxy)hept-4-en-3-yl]acetamide (PubChem CID 10522461) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E,3R,6S)-2-methyl-6-(phenylmethoxymethoxy)hept-4-en-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E,3R,6S)-2-methyl-6-(phenylmethoxymethoxy)hept-4-en-3-yl]acetamide |
|---|---|
| PubChem CID | 10522461 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E,3R,6S)-2-methyl-6-(phenylmethoxymethoxy)hept-4-en-3-yl]acetamide |
| SMILES | CC(C)[C@H](/C=C/[C@H](C)OCOCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO3/c1-13(2)16(22-17(23)18(19,20)21)10-9-14(3)25-12-24-11-15-7-5-4-6-8-15/h4-10,13-14,16H,11-12H2,1-3H3,(H,22,23)/b10-9+/t14-,16-/m0/s1 |
| InChIKey | PYDSSYNHCCPGIN-OOCSTFOJSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|