C16H17NO2 — CID 102350530
ethyl 3-(4-cyanophenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 102350530) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 3-(4-cyanophenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 3-(4-cyanophenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102350530 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl 3-(4-cyanophenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC=C(c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C16H17NO2/c1-2-19-16(18)15-5-3-4-14(10-15)13-8-6-12(11-17)7-9-13/h4,6-9,15H,2-3,5,10H2,1H3 |
| InChIKey | ORNNUHYNMVTWRC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |